C44H81N2O6P — CID 138151090
[(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]henicosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138151090) has the molecular formula C44H81N2O6P and a molecular weight of 765.11 g/mol. Its IUPAC name is [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]henicosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]henicosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138151090 |
| Molecular Formula | C44H81N2O6P |
| Molecular Weight | 765.11 g/mol |
| Exact Mass | 764.58 |
| IUPAC Name | [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]henicosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C=C/CCCCCCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CC/C=C/CCCCCCCC |
| InChI | InChI=1S/C44H81N2O6P/c1-6-8-10-12-14-16-18-20-22-24-25-27-29-31-33-35-37-43(47)42(41-52-53(49,50)51-40-39-46(3,4)5)45-44(48)38-36-34-32-30-28-26-23-21-19-17-15-13-11-9-7-2/h15,17,19-22,27,29,35,37,42-43,47H,6-14,16,18,23-26,28,30-34,36,38-41H2,1-5H3,(H-,45,48,49,50)/b17-15-,21-19-,22-20+,29-27+,37-35+ |
| InChIKey | FFFHRDBWFOMTOX-XQPSODKZSA-N |
| XLogP | 10.83 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.11 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|