C36H64O10 — CID 138126301
[1-heptanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 138126301) has the molecular formula C36H64O10 and a molecular weight of 656.90 g/mol. Its IUPAC name is [1-heptanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [1-heptanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 138126301 |
| Molecular Formula | C36H64O10 |
| Molecular Weight | 656.90 g/mol |
| Exact Mass | 656.45 |
| IUPAC Name | [1-heptanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C36H64O10/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-25-32(39)45-29(27-43-31(38)24-22-8-6-4-2)28-44-36-35(42)34(41)33(40)30(26-37)46-36/h10-11,13-14,29-30,33-37,40-42H,3-9,12,15-28H2,1-2H3/b11-10-,14-13- |
| InChIKey | BGTCQTFGKZTKDH-XVTLYKPTSA-N |
| XLogP | 5.82 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.90 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|