C33H61N2O6P — CID 138134079
[(4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]tetradeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138134079) has the molecular formula C33H61N2O6P and a molecular weight of 612.83 g/mol. Its IUPAC name is [(4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]tetradeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]tetradeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138134079 |
| Molecular Formula | C33H61N2O6P |
| Molecular Weight | 612.83 g/mol |
| Exact Mass | 612.43 |
| IUPAC Name | [(4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]tetradeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C33H61N2O6P/c1-6-8-10-12-14-16-17-19-21-23-25-27-33(37)34-31(30-41-42(38,39)40-29-28-35(3,4)5)32(36)26-24-22-20-18-15-13-11-9-7-2/h7,9,12,14-15,18,24,26,31-32,36H,6,8,10-11,13,16-17,19-23,25,27-30H2,1-5H3,(H-,34,37,38,39)/b9-7+,14-12-,18-15+,26-24+ |
| InChIKey | CEOXRHDSTKCRGQ-AXJPNFDKSA-N |
| XLogP | 6.77 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.83 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|