C27H45O8P — CID 138160709
(1-hexanoyloxy-3-phosphonooxypropan-2-yl) (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate (PubChem CID 138160709) has the molecular formula C27H45O8P and a molecular weight of 528.62 g/mol. Its IUPAC name is (1-hexanoyloxy-3-phosphonooxypropan-2-yl) (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | (1-hexanoyloxy-3-phosphonooxypropan-2-yl) (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 138160709 |
| Molecular Formula | C27H45O8P |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (1-hexanoyloxy-3-phosphonooxypropan-2-yl) (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C27H45O8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20-22-27(29)35-25(24-34-36(30,31)32)23-33-26(28)21-19-6-4-2/h5,7,9-10,12-13,15-16,25H,3-4,6,8,11,14,17-24H2,1-2H3,(H2,30,31,32)/b7-5-,10-9-,13-12-,16-15- |
| InChIKey | GJICBXFCXZBUFF-KUXGPOOQSA-N |
| XLogP | 6.50 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|