C27H52NO7P — CID 138168649
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propan-2-yl] hexanoate (PubChem CID 138168649) has the molecular formula C27H52NO7P and a molecular weight of 533.69 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propan-2-yl] hexanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propan-2-yl] hexanoate |
|---|---|
| PubChem CID | 138168649 |
| Molecular Formula | C27H52NO7P |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propan-2-yl] hexanoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCC |
| InChI | InChI=1S/C27H52NO7P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-22-32-24-26(35-27(29)20-18-6-4-2)25-34-36(30,31)33-23-21-28/h7-8,10-11,26H,3-6,9,12-25,28H2,1-2H3,(H,30,31)/b8-7-,11-10- |
| InChIKey | HIAAGKQSFOHMTQ-NQLNTKRDSA-N |
| XLogP | 6.62 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|