C41H74NO7P — CID 138123977
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 138123977) has the molecular formula C41H74NO7P and a molecular weight of 724.02 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138123977 |
| Molecular Formula | C41H74NO7P |
| Molecular Weight | 724.02 g/mol |
| Exact Mass | 723.52 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\C/C=C\CCC |
| InChI | InChI=1S/C41H74NO7P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-36-46-38-40(39-48-50(44,45)47-37-35-42)49-41(43)34-32-30-28-26-24-22-16-14-12-10-8-6-4-2/h5,7-8,10-11,13-14,16-18,40H,3-4,6,9,12,15,19-39,42H2,1-2H3,(H,44,45)/b7-5-,10-8-,13-11-,16-14-,18-17- |
| InChIKey | AZMKIWYYMHQBHM-NOGDRUJUSA-N |
| XLogP | 11.41 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.02 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|