C38H68NO7P — CID 164505222
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoxy]propan-2-yl] heptanoate (PubChem CID 164505222) has the molecular formula C38H68NO7P and a molecular weight of 681.94 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoxy]propan-2-yl] heptanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoxy]propan-2-yl] heptanoate |
|---|---|
| PubChem CID | 164505222 |
| Molecular Formula | C38H68NO7P |
| Molecular Weight | 681.94 g/mol |
| Exact Mass | 681.47 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z,20Z,23Z)-hexacosa-11,14,17,20,23-pentaenoxy]propan-2-yl] heptanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCC |
| InChI | InChI=1S/C38H68NO7P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30-33-43-35-37(36-45-47(41,42)44-34-32-39)46-38(40)31-29-8-6-4-2/h5,7,10-11,13-14,16-17,19-20,37H,3-4,6,8-9,12,15,18,21-36,39H2,1-2H3,(H,41,42)/b7-5-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | ZPOKEYVSDMQUOS-GJCLIZKUSA-N |
| XLogP | 10.24 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.94 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|