C39H72NO7P — CID 138141442
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (Z)-hexadec-9-enoate (PubChem CID 138141442) has the molecular formula C39H72NO7P and a molecular weight of 697.98 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (Z)-hexadec-9-enoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 138141442 |
| Molecular Formula | C39H72NO7P |
| Molecular Weight | 697.98 g/mol |
| Exact Mass | 697.50 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (Z)-hexadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C39H72NO7P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-34-44-36-38(37-46-48(42,43)45-35-33-40)47-39(41)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-18,38H,3-4,6,8-10,12,15,19-37,40H2,1-2H3,(H,42,43)/b7-5-,13-11-,16-14-,18-17- |
| InChIKey | DBLNCTBOLXPQSM-MVXJGUQMSA-N |
| XLogP | 10.85 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.98 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|