C43H78NO7P — CID 138275045
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 138275045) has the molecular formula C43H78NO7P and a molecular weight of 752.07 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138275045 |
| Molecular Formula | C43H78NO7P |
| Molecular Weight | 752.07 g/mol |
| Exact Mass | 751.55 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H78NO7P/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-38-48-40-42(41-50-52(46,47)49-39-37-44)51-43(45)36-34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-19,22,42H,3-4,6,8-10,15-16,20-21,23-41,44H2,1-2H3,(H,46,47)/b7-5-,13-11-,14-12-,19-17-,22-18- |
| InChIKey | UTNNRAHBEXDEJN-QQJFGNJVSA-N |
| XLogP | 12.19 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.07 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|