C30H54NO7P — CID 138236561
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] heptanoate (PubChem CID 138236561) has the molecular formula C30H54NO7P and a molecular weight of 571.74 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] heptanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] heptanoate |
|---|---|
| PubChem CID | 138236561 |
| Molecular Formula | C30H54NO7P |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] heptanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCC |
| InChI | InChI=1S/C30H54NO7P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-25-35-27-29(28-37-39(33,34)36-26-24-31)38-30(32)23-21-8-6-4-2/h5,7,10-11,13-14,16-17,29H,3-4,6,8-9,12,15,18-28,31H2,1-2H3,(H,33,34)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | PLEKMHVDPWJOIS-ZRENGBSJSA-N |
| XLogP | 7.34 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|