C44H80NO7P — CID 138126737
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (Z)-henicos-11-enoate (PubChem CID 138126737) has the molecular formula C44H80NO7P and a molecular weight of 766.10 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (Z)-henicos-11-enoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138126737 |
| Molecular Formula | C44H80NO7P |
| Molecular Weight | 766.10 g/mol |
| Exact Mass | 765.57 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (Z)-henicos-11-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C44H80NO7P/c1-3-5-7-9-11-13-15-17-19-21-22-23-25-27-29-31-33-35-37-44(46)52-43(42-51-53(47,48)50-40-38-45)41-49-39-36-34-32-30-28-26-24-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,18-21,26,28,43H,3-5,7,9-11,13,15-17,22-25,27,29-42,45H2,1-2H3,(H,47,48)/b8-6-,14-12-,20-18-,21-19-,28-26- |
| InChIKey | BIABLMQHARMWTJ-WFRGXPDMSA-N |
| XLogP | 12.58 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.10 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|