C35H64NO7P — CID 138283001
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 138283001) has the molecular formula C35H64NO7P and a molecular weight of 641.87 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 138283001 |
| Molecular Formula | C35H64NO7P |
| Molecular Weight | 641.87 g/mol |
| Exact Mass | 641.44 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COCCCCCCCC/C=C\CCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C35H64NO7P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-35(37)43-34(33-42-44(38,39)41-31-29-36)32-40-30-27-25-23-21-19-16-14-12-10-8-6-4-2/h5,7,10-13,17-18,34H,3-4,6,8-9,14-16,19-33,36H2,1-2H3,(H,38,39)/b7-5-,12-10-,13-11-,18-17- |
| InChIKey | VSHBBKCKYCMZEW-BFOXCHDTSA-N |
| XLogP | 9.29 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.87 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|