C36H68NO7P — CID 138279173
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propan-2-yl] nonanoate (PubChem CID 138279173) has the molecular formula C36H68NO7P and a molecular weight of 657.91 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propan-2-yl] nonanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propan-2-yl] nonanoate |
|---|---|
| PubChem CID | 138279173 |
| Molecular Formula | C36H68NO7P |
| Molecular Weight | 657.91 g/mol |
| Exact Mass | 657.47 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]propan-2-yl] nonanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C36H68NO7P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-28-31-41-33-35(34-43-45(39,40)42-32-30-37)44-36(38)29-27-25-10-8-6-4-2/h11-12,14-15,17-18,35H,3-10,13,16,19-34,37H2,1-2H3,(H,39,40)/b12-11-,15-14-,18-17- |
| InChIKey | VGHOJZLJUWJECV-IHDWIWDKSA-N |
| XLogP | 9.91 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.91 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|