C28H52NO10P — CID 138178761
2-amino-3-[hydroxy-[3-octanoyloxy-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 138178761) has the molecular formula C28H52NO10P and a molecular weight of 593.70 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-[3-octanoyloxy-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-[3-octanoyloxy-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138178761 |
| Molecular Formula | C28H52NO10P |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | 2-amino-3-[hydroxy-[3-octanoyloxy-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C28H52NO10P/c1-3-5-7-9-10-11-12-13-14-16-18-20-27(31)39-24(21-36-26(30)19-17-15-8-6-4-2)22-37-40(34,35)38-23-25(29)28(32)33/h9-10,24-25H,3-8,11-23,29H2,1-2H3,(H,32,33)(H,34,35)/b10-9- |
| InChIKey | INJXTRIQRNISSM-KTKRTIGZSA-N |
| XLogP | 5.82 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|