C37H63NO8P+ — CID 138202766
2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138202766) has the molecular formula C37H63NO8P+ and a molecular weight of 680.88 g/mol. Its IUPAC name is 2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138202766 |
| Molecular Formula | C37H63NO8P+ |
| Molecular Weight | 680.88 g/mol |
| Exact Mass | 680.43 |
| IUPAC Name | 2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C37H62NO8P/c1-6-8-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28-30-37(40)46-35(33-43-36(39)29-27-11-9-7-2)34-45-47(41,42)44-32-31-38(3,4)5/h8,10,13-14,16-17,19-20,22-23,25-26,35H,6-7,9,11-12,15,18,21,24,27-34H2,1-5H3/p+1/b10-8-,14-13-,17-16-,20-19-,23-22-,26-25- |
| InChIKey | LJXFFFJRINLEIY-QUAAIENRSA-O |
| XLogP | 8.73 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.88 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|