C38H65NO8P+ — CID 138270044
2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138270044) has the molecular formula C38H65NO8P+ and a molecular weight of 694.91 g/mol. Its IUPAC name is 2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138270044 |
| Molecular Formula | C38H65NO8P+ |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.44 |
| IUPAC Name | 2-[[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C38H64NO8P/c1-6-8-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27-29-31-38(41)47-36(34-44-37(40)30-28-26-11-9-7-2)35-46-48(42,43)45-33-32-39(3,4)5/h8,10,13-14,16-17,19-20,22-23,25,27,36H,6-7,9,11-12,15,18,21,24,26,28-35H2,1-5H3/p+1/b10-8-,14-13-,17-16-,20-19-,23-22-,27-25- |
| InChIKey | UEAGIABUXIUQCP-OOKUQGPRSA-O |
| XLogP | 9.12 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|