C40H69NO8P+ — CID 138285743
2-[[3-decanoyloxy-2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138285743) has the molecular formula C40H69NO8P+ and a molecular weight of 722.97 g/mol. Its IUPAC name is 2-[[3-decanoyloxy-2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-decanoyloxy-2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138285743 |
| Molecular Formula | C40H69NO8P+ |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.48 |
| IUPAC Name | 2-[[3-decanoyloxy-2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C40H68NO8P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-24-25-27-29-31-33-40(43)49-38(37-48-50(44,45)47-35-34-41(3,4)5)36-46-39(42)32-30-28-26-13-11-9-7-2/h8,10,14-15,17-18,20-21,23-24,27,29,38H,6-7,9,11-13,16,19,22,25-26,28,30-37H2,1-5H3/p+1/b10-8-,15-14-,18-17-,21-20-,24-23-,29-27- |
| InChIKey | WAPYNWWTRAXZTC-FWXCUEABSA-O |
| XLogP | 9.90 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|