C26H44O4 — CID 138204470
7-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxydecanoic acid (PubChem CID 138204470) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is 7-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxydecanoic acid.
| Compound Name | 7-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxydecanoic acid |
|---|---|
| PubChem CID | 138204470 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | 7-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxydecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(CCC)CCCCCC(=O)O |
| InChI | InChI=1S/C26H44O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-19-23-26(29)30-24(20-4-2)21-17-16-18-22-25(27)28/h5-6,8-9,11-12,24H,3-4,7,10,13-23H2,1-2H3,(H,27,28)/b6-5-,9-8-,12-11- |
| InChIKey | LPJJPHTXUIOQFQ-AGRJPVHOSA-N |
| XLogP | 7.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|