C28H48O4 — CID 138312809
7-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxydecanoic acid (PubChem CID 138312809) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is 7-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxydecanoic acid.
| Compound Name | 7-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxydecanoic acid |
|---|---|
| PubChem CID | 138312809 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 7-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxydecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CCC)CCCCCC(=O)O |
| InChI | InChI=1S/C28H48O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-21-25-28(31)32-26(22-4-2)23-19-18-20-24-27(29)30/h5-6,8-9,11-12,26H,3-4,7,10,13-25H2,1-2H3,(H,29,30)/b6-5-,9-8-,12-11- |
| InChIKey | ZHCOENMHTWMALL-AGRJPVHOSA-N |
| XLogP | 8.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|