C31H58NO8P — CID 138206110
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate (PubChem CID 138206110) has the molecular formula C31H58NO8P and a molecular weight of 603.78 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138206110 |
| Molecular Formula | C31H58NO8P |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 603.39 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C31H58NO8P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-31(34)40-29(28-39-41(35,36)38-26-25-32)27-37-30(33)23-21-8-6-4-2/h11-12,14-15,29H,3-10,13,16-28,32H2,1-2H3,(H,35,36)/b12-11-,15-14- |
| InChIKey | LUFZVIFNMAOJGZ-HDXUUTQWSA-N |
| XLogP | 7.71 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|