C45H78NO10P — CID 138217116
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E)-19,20-dihydroxydocosa-4,7,10,13,16-pentaenoate (PubChem CID 138217116) has the molecular formula C45H78NO10P and a molecular weight of 824.09 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E)-19,20-dihydroxydocosa-4,7,10,13,16-pentaenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E)-19,20-dihydroxydocosa-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 138217116 |
| Molecular Formula | C45H78NO10P |
| Molecular Weight | 824.09 g/mol |
| Exact Mass | 823.54 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E)-19,20-dihydroxydocosa-4,7,10,13,16-pentaenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CC(O)C(O)CC |
| InChI | InChI=1S/C45H78NO10P/c1-3-5-6-7-8-9-10-11-13-17-20-23-26-29-32-35-44(49)53-39-41(40-55-57(51,52)54-38-37-46)56-45(50)36-33-30-27-24-21-18-15-12-14-16-19-22-25-28-31-34-43(48)42(47)4-2/h11-14,18-19,21-22,27-28,30-31,41-43,47-48H,3-10,15-17,20,23-26,29,32-40,46H2,1-2H3,(H,51,52)/b13-11-,14-12+,21-18+,22-19+,30-27+,31-28+ |
| InChIKey | NCJZYRPYLFOVCJ-PEOSMMRSSA-N |
| XLogP | 10.21 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.09 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|