C17H31NO7 — CID 138217582
4-(3-acetyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate (PubChem CID 138217582) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-(3-acetyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-(3-acetyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 138217582 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 4-(3-acetyloxy-2-pentanoyloxypropoxy)-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(C)=O |
| InChI | InChI=1S/C17H31NO7/c1-6-7-8-16(20)25-14(12-24-13(2)19)11-23-10-9-15(17(21)22)18(3,4)5/h14-15H,6-12H2,1-5H3 |
| InChIKey | NDUSGVHCSSQTSD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|