C17H15NO3S — CID 1382277
N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylbenzamide (PubChem CID 1382277) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylbenzamide.
| Compound Name | N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 1382277 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylbenzamide |
| SMILES | O=C(c1ccccc1)N(c1ccccc1)[C@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C17H15NO3S/c19-17(14-7-3-1-4-8-14)18(15-9-5-2-6-10-15)16-11-12-22(20,21)13-16/h1-12,16H,13H2/t16-/m0/s1 |
| InChIKey | WPEAPXCOOVMMSS-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |