About ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate
ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate (PubChem CID 102566492) has the molecular formula C13H15NO4S
and a molecular weight of 281.33 g/mol. Its IUPAC name is ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate.
Molecular Properties
| Compound Name | ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate |
| PubChem CID | 102566492 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate |
| SMILES | CCOC(=O)N(c1ccccc1)C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO4S/c1-2-18-13(15)14(11-6-4-3-5-7-11)12-8-9-19(16,17)10-12/h3-9,12H,2,10H2,1H3 |
| InChIKey | RFTBJRDZBIEXHB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate?
The IUPAC name of ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate (CID 102566492) is ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate.
What is the SMILES notation for ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate?
The canonical SMILES for ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate is CCOC(=O)N(c1ccccc1)C1C=CS(=O)(=O)C1.
What is the InChIKey of ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate?
The InChIKey is RFTBJRDZBIEXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4S/c1-2-18-13(15)14(11-6-4-3-5-7-11)12-8-9-19(16,17)10-12/h3-9,12H,2,10H2,1H3.
What are the key properties of ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate?
ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate has a molecular weight of 281.33 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylcarbamate is sourced from PubChem (CID 102566492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).