C15H19NO3S — CID 40505612
N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylpentanamide (PubChem CID 40505612) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylpentanamide.
| Compound Name | N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylpentanamide |
|---|---|
| PubChem CID | 40505612 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-N-phenylpentanamide |
| SMILES | CCCCC(=O)N(c1ccccc1)[C@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO3S/c1-2-3-9-15(17)16(13-7-5-4-6-8-13)14-10-11-20(18,19)12-14/h4-8,10-11,14H,2-3,9,12H2,1H3/t14-/m0/s1 |
| InChIKey | WCFVGTMKWNPNJV-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |