C13H15NO3S — CID 6619989
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylpropanamide (PubChem CID 6619989) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylpropanamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 6619989 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO3S/c1-2-13(15)14(11-6-4-3-5-7-11)12-8-9-18(16,17)10-12/h3-9,12H,2,10H2,1H3 |
| InChIKey | CNYSUYQRUYCTKD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |