C46H85NO9P+ — CID 138234769
2-[[2-[(6E,8E,10E,14E)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138234769) has the molecular formula C46H85NO9P+ and a molecular weight of 827.16 g/mol. Its IUPAC name is 2-[[2-[(6E,8E,10E,14E)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(6E,8E,10E,14E)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138234769 |
| Molecular Formula | C46H85NO9P+ |
| Molecular Weight | 827.16 g/mol |
| Exact Mass | 826.60 |
| IUPAC Name | 2-[[2-[(6E,8E,10E,14E)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C/CC(O)/C=C/C=C/C=C/C(O)CCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H84NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-27-31-39-53-41-45(42-55-57(51,52)54-40-38-47(3,4)5)56-46(50)37-32-36-44(49)35-30-26-25-29-34-43(48)33-28-24-13-11-9-7-2/h17-18,24-26,28-30,34-35,43-45,48-49H,6-16,19-23,27,31-33,36-42H2,1-5H3/p+1/b18-17-,26-25+,28-24+,34-29+,35-30+ |
| InChIKey | PFRYPRFEDWJZLW-PSSPOSSPSA-O |
| XLogP | 10.88 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.16 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|