C42H75NO10P+ — CID 156989223
2-[[(2R)-2-[(5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 156989223) has the molecular formula C42H75NO10P+ and a molecular weight of 785.03 g/mol. Its IUPAC name is 2-[[(2R)-2-[(5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-[(5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156989223 |
| Molecular Formula | C42H75NO10P+ |
| Molecular Weight | 785.03 g/mol |
| Exact Mass | 784.51 |
| IUPAC Name | 2-[[(2R)-2-[(5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCC[C@@H](O)/C=C\C=C\C=C\[C@@H](O)C/C=C\CCCCC |
| InChI | InChI=1S/C42H74NO10P/c1-6-8-10-12-14-15-16-17-18-20-26-32-41(46)50-36-40(37-52-54(48,49)51-35-34-43(3,4)5)53-42(47)33-27-31-39(45)30-25-22-21-24-29-38(44)28-23-19-13-11-9-7-2/h12,14,19,21-25,29-30,38-40,44-45H,6-11,13,15-18,20,26-28,31-37H2,1-5H3/p+1/b14-12-,22-21+,23-19-,29-24+,30-25-/t38-,39-,40+/m0/s1 |
| InChIKey | KVQHWTYPDFLAJP-YFOZHHSBSA-O |
| XLogP | 8.85 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.03 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|