C44H76NO7P — CID 138238971
[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138238971) has the molecular formula C44H76NO7P and a molecular weight of 762.07 g/mol. Its IUPAC name is [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138238971 |
| Molecular Formula | C44H76NO7P |
| Molecular Weight | 762.07 g/mol |
| Exact Mass | 761.54 |
| IUPAC Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C/C=C\CCC |
| InChI | InChI=1S/C44H76NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-28-30-32-34-36-39-49-41-43(42-51-53(47,48)50-40-38-45(3,4)5)52-44(46)37-35-33-31-29-27-25-19-17-15-13-11-9-7-2/h8,10-11,13-14,16-17,19-21,23-24,28,30,43H,6-7,9,12,15,18,22,25-27,29,31-42H2,1-5H3/b10-8-,13-11-,16-14-,19-17-,21-20-,24-23-,30-28- |
| InChIKey | PSFFBJATXCHCRH-BUYQRXEUSA-N |
| XLogP | 11.08 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.07 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|