C52H88NO7P — CID 165198915
[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165198915) has the molecular formula C52H88NO7P and a molecular weight of 870.25 g/mol. Its IUPAC name is [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165198915 |
| Molecular Formula | C52H88NO7P |
| Molecular Weight | 870.25 g/mol |
| Exact Mass | 869.63 |
| IUPAC Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C/C=C\CCC |
| InChI | InChI=1S/C52H88NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-28-29-30-31-32-34-36-38-40-42-44-47-57-49-51(50-59-61(55,56)58-48-46-53(3,4)5)60-52(54)45-43-41-39-37-35-33-19-17-15-13-11-9-7-2/h8,10-11,13-14,16-17,19-21,23-24,26-27,29-30,32,34,51H,6-7,9,12,15,18,22,25,28,31,33,35-50H2,1-5H3/b10-8-,13-11-,16-14-,19-17-,21-20-,24-23-,27-26-,30-29-,34-32- |
| InChIKey | CUHSESNOVTZDOG-AVUMMOMTSA-N |
| XLogP | 13.75 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.25 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|