C39H72NO7P — CID 165282476
[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165282476) has the molecular formula C39H72NO7P and a molecular weight of 697.98 g/mol. Its IUPAC name is [2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165282476 |
| Molecular Formula | C39H72NO7P |
| Molecular Weight | 697.98 g/mol |
| Exact Mass | 697.50 |
| IUPAC Name | [2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-[(Z)-tridec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(COCCCCCCCC/C=C\CCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C39H72NO7P/c1-6-8-10-12-14-16-18-19-20-21-22-24-26-28-30-32-39(41)47-38(37-46-48(42,43)45-35-33-40(3,4)5)36-44-34-31-29-27-25-23-17-15-13-11-9-7-2/h8,10-11,13-14,16,19-20,38H,6-7,9,12,15,17-18,21-37H2,1-5H3/b10-8-,13-11-,16-14-,20-19- |
| InChIKey | QOQOBBBYMITBQI-UXDKAUAHSA-N |
| XLogP | 9.80 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.98 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|