C36H66N2O6P+ — CID 138239903
2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxypentadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138239903) has the molecular formula C36H66N2O6P+ and a molecular weight of 653.91 g/mol. Its IUPAC name is 2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxypentadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxypentadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138239903 |
| Molecular Formula | C36H66N2O6P+ |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.47 |
| IUPAC Name | 2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxypentadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCC[N+](C)(C)C)NC(=O)CC/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C36H65N2O6P/c1-6-8-10-12-14-16-18-19-20-22-24-26-28-30-36(40)37-34(33-44-45(41,42)43-32-31-38(3,4)5)35(39)29-27-25-23-21-17-15-13-11-9-7-2/h9,11,17,19-21,24,26-27,29,34-35,39H,6-8,10,12-16,18,22-23,25,28,30-33H2,1-5H3,(H-,37,40,41,42)/p+1/b11-9+,20-19-,21-17+,26-24-,29-27+ |
| InChIKey | PUZUVKRARSYXII-WSTATNKWSA-O |
| XLogP | 8.34 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|