C37H68N2O6P+ — CID 138176756
2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyhexadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138176756) has the molecular formula C37H68N2O6P+ and a molecular weight of 667.93 g/mol. Its IUPAC name is 2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyhexadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyhexadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138176756 |
| Molecular Formula | C37H68N2O6P+ |
| Molecular Weight | 667.93 g/mol |
| Exact Mass | 667.48 |
| IUPAC Name | 2-[[(4E,8E,12E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyhexadeca-4,8,12-trienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCC[N+](C)(C)C)NC(=O)CC/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C37H67N2O6P/c1-6-8-10-12-14-16-18-19-21-23-25-27-29-31-37(41)38-35(34-45-46(42,43)44-33-32-39(3,4)5)36(40)30-28-26-24-22-20-17-15-13-11-9-7-2/h11,13,19-22,25,27-28,30,35-36,40H,6-10,12,14-18,23-24,26,29,31-34H2,1-5H3,(H-,38,41,42,43)/p+1/b13-11+,21-19-,22-20+,27-25-,30-28+ |
| InChIKey | IHFGVFCTAWSUMW-UHXFAKPMSA-O |
| XLogP | 8.73 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.93 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|