C38H72N2O6P+ — CID 138259431
2-[[(4E,8E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyheptadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138259431) has the molecular formula C38H72N2O6P+ and a molecular weight of 683.98 g/mol. Its IUPAC name is 2-[[(4E,8E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyheptadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(4E,8E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyheptadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138259431 |
| Molecular Formula | C38H72N2O6P+ |
| Molecular Weight | 683.98 g/mol |
| Exact Mass | 683.51 |
| IUPAC Name | 2-[[(4E,8E)-2-[[(4Z,7Z)-hexadeca-4,7-dienoyl]amino]-3-hydroxyheptadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\C/C=C\CCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CCCCCCCC |
| InChI | InChI=1S/C38H71N2O6P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-38(42)39-36(35-46-47(43,44)45-34-33-40(3,4)5)37(41)31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,26,28-29,31,36-37,41H,6-19,24-25,27,30,32-35H2,1-5H3,(H-,39,42,43,44)/p+1/b22-20-,23-21+,28-26-,31-29+ |
| InChIKey | SDMSDDMNJZCFKO-CNYCJXTGSA-O |
| XLogP | 9.35 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.98 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|