C46H78O10 — CID 138247667
[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138247667) has the molecular formula C46H78O10 and a molecular weight of 791.12 g/mol. Its IUPAC name is [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138247667 |
| Molecular Formula | C46H78O10 |
| Molecular Weight | 791.12 g/mol |
| Exact Mass | 790.56 |
| IUPAC Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C46H78O10/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-24-26-28-30-32-34-41(48)53-37-39(38-54-46-45(52)44(51)43(50)40(36-47)56-46)55-42(49)35-33-31-29-27-25-22-16-14-12-10-8-6-4-2/h6,8,12-15,18-19,22,25,39-40,43-47,50-52H,3-5,7,9-11,16-17,20-21,23-24,26-38H2,1-2H3/b8-6-,14-12-,15-13-,19-18-,25-22- |
| InChIKey | QTPOHUOQQFIDQY-WJLXNZINSA-N |
| XLogP | 9.05 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.12 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|