C39H72O4 — CID 138254520
9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid (PubChem CID 138254520) has the molecular formula C39H72O4 and a molecular weight of 605.00 g/mol. Its IUPAC name is 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid.
| Compound Name | 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid |
|---|---|
| PubChem CID | 138254520 |
| Molecular Formula | C39H72O4 |
| Molecular Weight | 605.00 g/mol |
| Exact Mass | 604.54 |
| IUPAC Name | 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCCCCCC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C39H72O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-28-32-36-39(42)43-37(33-29-25-22-12-10-8-6-4-2)34-30-26-24-27-31-35-38(40)41/h11,13,15-16,37H,3-10,12,14,17-36H2,1-2H3,(H,40,41)/b13-11-,16-15- |
| InChIKey | ROQHLDGIDOUEBC-DURLKXOLSA-N |
| XLogP | 12.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.00 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|