9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid

C39H72O4 — CID 138254520

IUPAC9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCCCCCC)CCCCCCCC(=O)O
InChIInChI=1S/C39H72O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-28-32-36-39(42)43-37(33-29-25-22-12-10-8-6-4-2)34-30-26-24-27-31-35-38(40)41/h11,13,15-16,37H,3-10,12,14,17-36H2,1-2H3,(H,40,41)/b13-11-,16-15-
InChIKeyROQHLDGIDOUEBC-DURLKXOLSA-N
MW605.00 g/mol
LogP12.84
Rot. Bonds34

About 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid

9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid (PubChem CID 138254520) has the molecular formula C39H72O4 and a molecular weight of 605.00 g/mol. Its IUPAC name is 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid.

Molecular Properties

Compound Name9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid
PubChem CID138254520
Molecular FormulaC39H72O4
Molecular Weight605.00 g/mol
Exact Mass604.54
IUPAC Name9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCCCCCC)CCCCCCCC(=O)O
InChIInChI=1S/C39H72O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-28-32-36-39(42)43-37(33-29-25-22-12-10-8-6-4-2)34-30-26-24-27-31-35-38(40)41/h11,13,15-16,37H,3-10,12,14,17-36H2,1-2H3,(H,40,41)/b13-11-,16-15-
InChIKeyROQHLDGIDOUEBC-DURLKXOLSA-N
XLogP12.84
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds34
Heavy Atoms43
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500605.00
LogP ≤ 512.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid?
The IUPAC name of 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid (CID 138254520) is 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid.
What is the SMILES notation for 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid?
The canonical SMILES for 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid is CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCCCCCC)CCCCCCCC(=O)O.
What is the InChIKey of 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid?
The InChIKey is ROQHLDGIDOUEBC-DURLKXOLSA-N. The full InChI is InChI=1S/C39H72O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-28-32-36-39(42)43-37(33-29-25-22-12-10-8-6-4-2)34-30-26-24-27-31-35-38(40)41/h11,13,15-16,37H,3-10,12,14,17-36H2,1-2H3,(H,40,41)/b13-11-,16-15-.
What are the key properties of 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid?
9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid has a molecular weight of 605.00 g/mol, XLogP of 12.84, 34 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(11Z,14Z)-icosa-11,14-dienoyl]oxynonadecanoic acid is sourced from PubChem (CID 138254520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).