C21H39O8P — CID 138255275
(1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tridec-9-enoate (PubChem CID 138255275) has the molecular formula C21H39O8P and a molecular weight of 450.51 g/mol. Its IUPAC name is (1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tridec-9-enoate.
| Compound Name | (1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tridec-9-enoate |
|---|---|
| PubChem CID | 138255275 |
| Molecular Formula | C21H39O8P |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tridec-9-enoate |
| SMILES | CCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCC)COP(=O)(O)O |
| InChI | InChI=1S/C21H39O8P/c1-3-5-7-8-9-10-11-12-13-14-16-21(23)29-19(18-28-30(24,25)26)17-27-20(22)15-6-4-2/h7-8,19H,3-6,9-18H2,1-2H3,(H2,24,25,26)/b8-7- |
| InChIKey | RQZUPIDFRMJGGI-FPLPWBNLSA-N |
| XLogP | 4.83 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|