C23H43O8P — CID 138318968
(1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-pentadec-9-enoate (PubChem CID 138318968) has the molecular formula C23H43O8P and a molecular weight of 478.56 g/mol. Its IUPAC name is (1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-pentadec-9-enoate.
| Compound Name | (1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 138318968 |
| Molecular Formula | C23H43O8P |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (1-pentanoyloxy-3-phosphonooxypropan-2-yl) (Z)-pentadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCC)COP(=O)(O)O |
| InChI | InChI=1S/C23H43O8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-23(25)31-21(20-30-32(26,27)28)19-29-22(24)17-6-4-2/h9-10,21H,3-8,11-20H2,1-2H3,(H2,26,27,28)/b10-9- |
| InChIKey | ZZTWCIDKGUXNLL-KTKRTIGZSA-N |
| XLogP | 5.61 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|