C39H67O10P — CID 138271095
[3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 138271095) has the molecular formula C39H67O10P and a molecular weight of 726.93 g/mol. Its IUPAC name is [3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138271095 |
| Molecular Formula | C39H67O10P |
| Molecular Weight | 726.93 g/mol |
| Exact Mass | 726.45 |
| IUPAC Name | [3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\C/C=C\CCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C39H67O10P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-38(42)46-34-37(35-48-50(44,45)47-33-36(41)32-40)49-39(43)31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h6,8-9,11-12,14-15,17-18,21,36-37,40-41H,3-5,7,10,13,16,19-20,22-35H2,1-2H3,(H,44,45)/b8-6-,11-9-,14-12-,17-15-,21-18- |
| InChIKey | UHGFNMRNUHETQG-LUQMBFCLSA-N |
| XLogP | 9.16 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.93 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|