C43H78O4 — CID 138282596
(15Z,18Z)-9-[(Z)-heptadec-9-enoyl]oxyhexacosa-15,18-dienoic acid (PubChem CID 138282596) has the molecular formula C43H78O4 and a molecular weight of 659.09 g/mol. Its IUPAC name is (15Z,18Z)-9-[(Z)-heptadec-9-enoyl]oxyhexacosa-15,18-dienoic acid.
| Compound Name | (15Z,18Z)-9-[(Z)-heptadec-9-enoyl]oxyhexacosa-15,18-dienoic acid |
|---|---|
| PubChem CID | 138282596 |
| Molecular Formula | C43H78O4 |
| Molecular Weight | 659.09 g/mol |
| Exact Mass | 658.59 |
| IUPAC Name | (15Z,18Z)-9-[(Z)-heptadec-9-enoyl]oxyhexacosa-15,18-dienoic acid |
| SMILES | CCCCCCC/C=C\C/C=C\CCCCCC(CCCCCCCC(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C43H78O4/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-29-33-37-41(38-34-30-28-31-35-39-42(44)45)47-43(46)40-36-32-27-25-23-21-18-16-14-12-10-8-6-4-2/h15-18,20,22,41H,3-14,19,21,23-40H2,1-2H3,(H,44,45)/b17-15-,18-16-,22-20- |
| InChIKey | VQZAHQPDLVNDOD-WAZCELLYSA-N |
| XLogP | 14.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.09 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|