C43H76NO8P — CID 138291058
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] 4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate (PubChem CID 138291058) has the molecular formula C43H76NO8P and a molecular weight of 766.05 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] 4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] 4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 138291058 |
| Molecular Formula | C43H76NO8P |
| Molecular Weight | 766.05 g/mol |
| Exact Mass | 765.53 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] 4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
| SMILES | CCCCC/C=C/C/C=C/C=C\C=C/C1OC1CCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H76NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-36-48-38-40(39-50-53(46,47)49-37-35-44)51-43(45)34-31-33-42-41(52-42)32-29-27-25-23-21-16-14-12-10-8-6-4-2/h12,14,17-18,21,23,25,27,29,32,40-42H,3-11,13,15-16,19-20,22,24,26,28,30-31,33-39,44H2,1-2H3,(H,46,47)/b14-12+,18-17-,23-21+,27-25-,32-29- |
| InChIKey | WROCNLYUEJNXKT-FCZLQABGSA-N |
| XLogP | 11.18 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.05 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|