C35H62O4 — CID 138297451
(9Z,12Z)-8-[(Z)-octadec-9-enoyl]oxyheptadeca-9,12-dienoic acid (PubChem CID 138297451) has the molecular formula C35H62O4 and a molecular weight of 546.88 g/mol. Its IUPAC name is (9Z,12Z)-8-[(Z)-octadec-9-enoyl]oxyheptadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-8-[(Z)-octadec-9-enoyl]oxyheptadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 138297451 |
| Molecular Formula | C35H62O4 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | (9Z,12Z)-8-[(Z)-octadec-9-enoyl]oxyheptadeca-9,12-dienoic acid |
| SMILES | CCCC/C=C\C/C=C\C(CCCCCCC(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C35H62O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-28-32-35(38)39-33(29-25-21-19-10-8-6-4-2)30-26-23-24-27-31-34(36)37/h10,14-15,19,25,29,33H,3-9,11-13,16-18,20-24,26-28,30-32H2,1-2H3,(H,36,37)/b15-14-,19-10-,29-25- |
| InChIKey | XLHCUFDKUDAWSU-YTCJFPOOSA-N |
| XLogP | 11.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|