C48H86O10 — CID 138304144
[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-henicos-11-enoate (PubChem CID 138304144) has the molecular formula C48H86O10 and a molecular weight of 823.21 g/mol. Its IUPAC name is [2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-henicos-11-enoate.
| Compound Name | [2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138304144 |
| Molecular Formula | C48H86O10 |
| Molecular Weight | 823.21 g/mol |
| Exact Mass | 822.62 |
| IUPAC Name | [2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-henicos-11-enoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C48H86O10/c1-3-5-7-9-11-13-15-17-19-20-21-23-24-26-28-30-32-34-36-43(50)55-39-41(40-56-48-47(54)46(53)45(52)42(38-49)58-48)57-44(51)37-35-33-31-29-27-25-22-18-16-14-12-10-8-6-4-2/h12,14,18-20,22,41-42,45-49,52-54H,3-11,13,15-17,21,23-40H2,1-2H3/b14-12-,20-19-,22-18- |
| InChIKey | YFTVGYZZQBDGIU-WMERUELCSA-N |
| XLogP | 10.28 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.21 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|