C23H32N2 — CID 138373985
1-(1-adamantyl)-3-[(2,4,6-trimethylphenyl)methyl]-2H-imidazole (PubChem CID 138373985) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(2,4,6-trimethylphenyl)methyl]-2H-imidazole.
| Compound Name | 1-(1-adamantyl)-3-[(2,4,6-trimethylphenyl)methyl]-2H-imidazole |
|---|---|
| PubChem CID | 138373985 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-(1-adamantyl)-3-[(2,4,6-trimethylphenyl)methyl]-2H-imidazole |
| SMILES | Cc1cc(C)c(CN2C=CN(C34CC5CC(CC(C5)C3)C4)C2)c(C)c1 |
| InChI | InChI=1S/C23H32N2/c1-16-6-17(2)22(18(3)7-16)14-24-4-5-25(15-24)23-11-19-8-20(12-23)10-21(9-19)13-23/h4-7,19-21H,8-15H2,1-3H3 |
| InChIKey | JNPPQYCPBFUVDC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |