C23H25Br2NO — CID 138374028
6-bromo-3'-methyl-4-phenylspiro[1,3,3a,4-tetrahydrobenzo[f]isoindol-2-ium-2,4'-1,4-oxazinan-4-ium] bromide (PubChem CID 138374028) has the molecular formula C23H25Br2NO and a molecular weight of 491.27 g/mol. Its IUPAC name is 6-bromo-3'-methyl-4-phenylspiro[1,3,3a,4-tetrahydrobenzo[f]isoindol-2-ium-2,4'-1,4-oxazinan-4-ium] bromide.
| Compound Name | 6-bromo-3'-methyl-4-phenylspiro[1,3,3a,4-tetrahydrobenzo[f]isoindol-2-ium-2,4'-1,4-oxazinan-4-ium] bromide |
|---|---|
| PubChem CID | 138374028 |
| Molecular Formula | C23H25Br2NO |
| Molecular Weight | 491.27 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 6-bromo-3'-methyl-4-phenylspiro[1,3,3a,4-tetrahydrobenzo[f]isoindol-2-ium-2,4'-1,4-oxazinan-4-ium] bromide |
| SMILES | CC1COCC[N+]12CC1=Cc3ccc(Br)cc3C(c3ccccc3)C1C2.[Br-] |
| InChI | InChI=1S/C23H25BrNO.BrH/c1-16-15-26-10-9-25(16)13-19-11-18-7-8-20(24)12-21(18)23(22(19)14-25)17-5-3-2-4-6-17;/h2-8,11-12,16,22-23H,9-10,13-15H2,1H3;1H/q+1;/p-1 |
| InChIKey | APFWVZXZTSDLNZ-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|