C27H32FN7O2 — CID 138374925
4-[[4-fluoro-3-[4-(2-methyl-1H-imidazo[4,5-b]pyridin-5-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one (PubChem CID 138374925) has the molecular formula C27H32FN7O2 and a molecular weight of 505.60 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[4-(2-methyl-1H-imidazo[4,5-b]pyridin-5-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[4-(2-methyl-1H-imidazo[4,5-b]pyridin-5-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 138374925 |
| Molecular Formula | C27H32FN7O2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 4-[[4-fluoro-3-[4-(2-methyl-1H-imidazo[4,5-b]pyridin-5-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
| SMILES | Cc1nc2nc(N3CCN(C(=O)c4cc(CC5NNC(=O)C6CCCCC56)ccc4F)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C27H32FN7O2/c1-16-29-22-8-9-24(31-25(22)30-16)34-10-12-35(13-11-34)27(37)20-14-17(6-7-21(20)28)15-23-18-4-2-3-5-19(18)26(36)33-32-23/h6-9,14,18-19,23,32H,2-5,10-13,15H2,1H3,(H,33,36)(H,29,30,31) |
| InChIKey | WDQVRVWOQWPLPZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |