C27H30F3N7O2 — CID 138374942
4-[[3-[4-(3H-imidazo[4,5-c]pyridin-6-yl)piperazine-1-carbonyl]-4-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one (PubChem CID 138374942) has the molecular formula C27H30F3N7O2 and a molecular weight of 541.58 g/mol. Its IUPAC name is 4-[[3-[4-(3H-imidazo[4,5-c]pyridin-6-yl)piperazine-1-carbonyl]-4-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[4-(3H-imidazo[4,5-c]pyridin-6-yl)piperazine-1-carbonyl]-4-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 138374942 |
| Molecular Formula | C27H30F3N7O2 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 4-[[3-[4-(3H-imidazo[4,5-c]pyridin-6-yl)piperazine-1-carbonyl]-4-(trifluoromethyl)phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
| SMILES | O=C1NNC(Cc2ccc(C(F)(F)F)c(C(=O)N3CCN(c4cc5nc[nH]c5cn4)CC3)c2)C2CCCCC12 |
| InChI | InChI=1S/C27H30F3N7O2/c28-27(29,30)20-6-5-16(12-21-17-3-1-2-4-18(17)25(38)35-34-21)11-19(20)26(39)37-9-7-36(8-10-37)24-13-22-23(14-31-24)33-15-32-22/h5-6,11,13-15,17-18,21,34H,1-4,7-10,12H2,(H,32,33)(H,35,38) |
| InChIKey | CZTLJNOYNONOAG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |