C27H29F4N7O2 — CID 138374926
4-[[4-fluoro-3-[4-[2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-5-yl]piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one (PubChem CID 138374926) has the molecular formula C27H29F4N7O2 and a molecular weight of 559.57 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[4-[2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-5-yl]piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[4-[2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-5-yl]piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 138374926 |
| Molecular Formula | C27H29F4N7O2 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 4-[[4-fluoro-3-[4-[2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-5-yl]piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
| SMILES | O=C1NNC(Cc2ccc(F)c(C(=O)N3CCN(c4ccc5[nH]c(C(F)(F)F)nc5n4)CC3)c2)C2CCCCC12 |
| InChI | InChI=1S/C27H29F4N7O2/c28-19-6-5-15(14-21-16-3-1-2-4-17(16)24(39)36-35-21)13-18(19)25(40)38-11-9-37(10-12-38)22-8-7-20-23(33-22)34-26(32-20)27(29,30)31/h5-8,13,16-17,21,35H,1-4,9-12,14H2,(H,36,39)(H,32,33,34) |
| InChIKey | JLBXGMLAYSYKMY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |