About (Z)-3-fluorooct-2-ene-1,8-diol
(Z)-3-fluorooct-2-ene-1,8-diol (PubChem CID 138375676) has the molecular formula C8H15FO2
and a molecular weight of 162.20 g/mol. Its IUPAC name is (Z)-3-fluorooct-2-ene-1,8-diol.
Molecular Properties
| Compound Name | (Z)-3-fluorooct-2-ene-1,8-diol |
| PubChem CID | 138375676 |
| Molecular Formula | C8H15FO2 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | (Z)-3-fluorooct-2-ene-1,8-diol |
| SMILES | OC/C=C(\F)CCCCCO |
| InChI | InChI=1S/C8H15FO2/c9-8(5-7-11)4-2-1-3-6-10/h5,10-11H,1-4,6-7H2/b8-5- |
| InChIKey | ZVAJLKQEGFHEGX-YVMONPNESA-N |
| XLogP | 1.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-fluorooct-2-ene-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-fluorooct-2-ene-1,8-diol?
The IUPAC name of (Z)-3-fluorooct-2-ene-1,8-diol (CID 138375676) is (Z)-3-fluorooct-2-ene-1,8-diol.
What is the SMILES notation for (Z)-3-fluorooct-2-ene-1,8-diol?
The canonical SMILES for (Z)-3-fluorooct-2-ene-1,8-diol is OC/C=C(\F)CCCCCO.
What is the InChIKey of (Z)-3-fluorooct-2-ene-1,8-diol?
The InChIKey is ZVAJLKQEGFHEGX-YVMONPNESA-N. The full InChI is InChI=1S/C8H15FO2/c9-8(5-7-11)4-2-1-3-6-10/h5,10-11H,1-4,6-7H2/b8-5-.
What are the key properties of (Z)-3-fluorooct-2-ene-1,8-diol?
(Z)-3-fluorooct-2-ene-1,8-diol has a molecular weight of 162.20 g/mol, XLogP of 1.38, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-fluorooct-2-ene-1,8-diol is sourced from PubChem (CID 138375676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).