About 2-fluorocyclohex-2-ene-1,4-diol
2-fluorocyclohex-2-ene-1,4-diol (PubChem CID 159338028) has the molecular formula C6H9FO2
and a molecular weight of 132.13 g/mol. Its IUPAC name is 2-fluorocyclohex-2-ene-1,4-diol.
Molecular Properties
| Compound Name | 2-fluorocyclohex-2-ene-1,4-diol |
| PubChem CID | 159338028 |
| Molecular Formula | C6H9FO2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-fluorocyclohex-2-ene-1,4-diol |
| SMILES | OC1C=C(F)C(O)CC1 |
| InChI | InChI=1S/C6H9FO2/c7-5-3-4(8)1-2-6(5)9/h3-4,6,8-9H,1-2H2 |
| InChIKey | LFUGMYVZIYSWJH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluorocyclohex-2-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorocyclohex-2-ene-1,4-diol?
The IUPAC name of 2-fluorocyclohex-2-ene-1,4-diol (CID 159338028) is 2-fluorocyclohex-2-ene-1,4-diol.
What is the SMILES notation for 2-fluorocyclohex-2-ene-1,4-diol?
The canonical SMILES for 2-fluorocyclohex-2-ene-1,4-diol is OC1C=C(F)C(O)CC1.
What is the InChIKey of 2-fluorocyclohex-2-ene-1,4-diol?
The InChIKey is LFUGMYVZIYSWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FO2/c7-5-3-4(8)1-2-6(5)9/h3-4,6,8-9H,1-2H2.
What are the key properties of 2-fluorocyclohex-2-ene-1,4-diol?
2-fluorocyclohex-2-ene-1,4-diol has a molecular weight of 132.13 g/mol, XLogP of 0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorocyclohex-2-ene-1,4-diol is sourced from PubChem (CID 159338028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).